C15H16F2N2O4 — CID 168561734
methyl 4-[4-(difluoromethyl)anilino]-1-(2-hydroxyethyl)-5-oxo-2H-pyrrole-3-carboxylate (PubChem CID 168561734) has the molecular formula C15H16F2N2O4 and a molecular weight of 326.30 g/mol. Its IUPAC name is methyl 4-[4-(difluoromethyl)anilino]-1-(2-hydroxyethyl)-5-oxo-2H-pyrrole-3-carboxylate.
| Compound Name | methyl 4-[4-(difluoromethyl)anilino]-1-(2-hydroxyethyl)-5-oxo-2H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 168561734 |
| Molecular Formula | C15H16F2N2O4 |
| Molecular Weight | 326.30 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | methyl 4-[4-(difluoromethyl)anilino]-1-(2-hydroxyethyl)-5-oxo-2H-pyrrole-3-carboxylate |
| SMILES | COC(=O)C1=C(Nc2ccc(C(F)F)cc2)C(=O)N(CCO)C1 |
| InChI | InChI=1S/C15H16F2N2O4/c1-23-15(22)11-8-19(6-7-20)14(21)12(11)18-10-4-2-9(3-5-10)13(16)17/h2-5,13,18,20H,6-8H2,1H3 |
| InChIKey | ZEESUNHVQCMHHJ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.30 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |