C17H24N2O7Si — CID 168563078
methyl 1-(2-hydroxyethyl)-5-oxo-4-(4-trimethoxysilylanilino)-2H-pyrrole-3-carboxylate (PubChem CID 168563078) has the molecular formula C17H24N2O7Si and a molecular weight of 396.47 g/mol. Its IUPAC name is methyl 1-(2-hydroxyethyl)-5-oxo-4-(4-trimethoxysilylanilino)-2H-pyrrole-3-carboxylate.
| Compound Name | methyl 1-(2-hydroxyethyl)-5-oxo-4-(4-trimethoxysilylanilino)-2H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 168563078 |
| Molecular Formula | C17H24N2O7Si |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | methyl 1-(2-hydroxyethyl)-5-oxo-4-(4-trimethoxysilylanilino)-2H-pyrrole-3-carboxylate |
| SMILES | COC(=O)C1=C(Nc2ccc([Si](OC)(OC)OC)cc2)C(=O)N(CCO)C1 |
| InChI | InChI=1S/C17H24N2O7Si/c1-23-17(22)14-11-19(9-10-20)16(21)15(14)18-12-5-7-13(8-6-12)27(24-2,25-3)26-4/h5-8,18,20H,9-11H2,1-4H3 |
| InChIKey | WFYPBGWSCTZKNP-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 106.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|