C24H18Cl2F5N3OS — CID 3344499
N-[3-chloro-4-[4-(2,3,4,5,6-pentafluorophenyl)piperazin-1-yl]phenyl]-2-(4-chlorophenyl)sulfanylacetamide (PubChem CID 3344499) has the molecular formula C24H18Cl2F5N3OS and a molecular weight of 562.39 g/mol. Its IUPAC name is N-[3-chloro-4-[4-(2,3,4,5,6-pentafluorophenyl)piperazin-1-yl]phenyl]-2-(4-chlorophenyl)sulfanylacetamide.
| Compound Name | N-[3-chloro-4-[4-(2,3,4,5,6-pentafluorophenyl)piperazin-1-yl]phenyl]-2-(4-chlorophenyl)sulfanylacetamide |
|---|---|
| PubChem CID | 3344499 |
| Molecular Formula | C24H18Cl2F5N3OS |
| Molecular Weight | 562.39 g/mol |
| Exact Mass | 561.05 |
| IUPAC Name | N-[3-chloro-4-[4-(2,3,4,5,6-pentafluorophenyl)piperazin-1-yl]phenyl]-2-(4-chlorophenyl)sulfanylacetamide |
| SMILES | O=C(CSc1ccc(Cl)cc1)Nc1ccc(N2CCN(c3c(F)c(F)c(F)c(F)c3F)CC2)c(Cl)c1 |
| InChI | InChI=1S/C24H18Cl2F5N3OS/c25-13-1-4-15(5-2-13)36-12-18(35)32-14-3-6-17(16(26)11-14)33-7-9-34(10-8-33)24-22(30)20(28)19(27)21(29)23(24)31/h1-6,11H,7-10,12H2,(H,32,35) |
| InChIKey | IXKJJWCIPICJQN-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.39 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|