C23H16ClF6N3O — CID 4593740
N-[3-chloro-4-[4-(2,3,4,5,6-pentafluorophenyl)piperazin-1-yl]phenyl]-4-fluorobenzamide (PubChem CID 4593740) has the molecular formula C23H16ClF6N3O and a molecular weight of 499.84 g/mol. Its IUPAC name is N-[3-chloro-4-[4-(2,3,4,5,6-pentafluorophenyl)piperazin-1-yl]phenyl]-4-fluorobenzamide.
| Compound Name | N-[3-chloro-4-[4-(2,3,4,5,6-pentafluorophenyl)piperazin-1-yl]phenyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 4593740 |
| Molecular Formula | C23H16ClF6N3O |
| Molecular Weight | 499.84 g/mol |
| Exact Mass | 499.09 |
| IUPAC Name | N-[3-chloro-4-[4-(2,3,4,5,6-pentafluorophenyl)piperazin-1-yl]phenyl]-4-fluorobenzamide |
| SMILES | O=C(Nc1ccc(N2CCN(c3c(F)c(F)c(F)c(F)c3F)CC2)c(Cl)c1)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H16ClF6N3O/c24-15-11-14(31-23(34)12-1-3-13(25)4-2-12)5-6-16(15)32-7-9-33(10-8-32)22-20(29)18(27)17(26)19(28)21(22)30/h1-6,11H,7-10H2,(H,31,34) |
| InChIKey | DLONCVLNSYJVLY-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.84 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|