C21H20ClF5N4OS — CID 3335429
N-[[3-chloro-4-[4-(2,3,4,5,6-pentafluorophenyl)piperazin-1-yl]phenyl]carbamothioyl]-2-methylpropanamide (PubChem CID 3335429) has the molecular formula C21H20ClF5N4OS and a molecular weight of 506.93 g/mol. Its IUPAC name is N-[[3-chloro-4-[4-(2,3,4,5,6-pentafluorophenyl)piperazin-1-yl]phenyl]carbamothioyl]-2-methylpropanamide.
| Compound Name | N-[[3-chloro-4-[4-(2,3,4,5,6-pentafluorophenyl)piperazin-1-yl]phenyl]carbamothioyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 3335429 |
| Molecular Formula | C21H20ClF5N4OS |
| Molecular Weight | 506.93 g/mol |
| Exact Mass | 506.10 |
| IUPAC Name | N-[[3-chloro-4-[4-(2,3,4,5,6-pentafluorophenyl)piperazin-1-yl]phenyl]carbamothioyl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)NC(=S)Nc1ccc(N2CCN(c3c(F)c(F)c(F)c(F)c3F)CC2)c(Cl)c1 |
| InChI | InChI=1S/C21H20ClF5N4OS/c1-10(2)20(32)29-21(33)28-11-3-4-13(12(22)9-11)30-5-7-31(8-6-30)19-17(26)15(24)14(23)16(25)18(19)27/h3-4,9-10H,5-8H2,1-2H3,(H2,28,29,32,33) |
| InChIKey | LNAWVLOTUZBIOB-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.93 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|