C25H21ClF5N3O2 — CID 4593742
N-[3-chloro-4-[4-(2,3,4,5,6-pentafluorophenyl)piperazin-1-yl]phenyl]-2-(3-methylphenoxy)acetamide (PubChem CID 4593742) has the molecular formula C25H21ClF5N3O2 and a molecular weight of 525.91 g/mol. Its IUPAC name is N-[3-chloro-4-[4-(2,3,4,5,6-pentafluorophenyl)piperazin-1-yl]phenyl]-2-(3-methylphenoxy)acetamide.
| Compound Name | N-[3-chloro-4-[4-(2,3,4,5,6-pentafluorophenyl)piperazin-1-yl]phenyl]-2-(3-methylphenoxy)acetamide |
|---|---|
| PubChem CID | 4593742 |
| Molecular Formula | C25H21ClF5N3O2 |
| Molecular Weight | 525.91 g/mol |
| Exact Mass | 525.12 |
| IUPAC Name | N-[3-chloro-4-[4-(2,3,4,5,6-pentafluorophenyl)piperazin-1-yl]phenyl]-2-(3-methylphenoxy)acetamide |
| SMILES | Cc1cccc(OCC(=O)Nc2ccc(N3CCN(c4c(F)c(F)c(F)c(F)c4F)CC3)c(Cl)c2)c1 |
| InChI | InChI=1S/C25H21ClF5N3O2/c1-14-3-2-4-16(11-14)36-13-19(35)32-15-5-6-18(17(26)12-15)33-7-9-34(10-8-33)25-23(30)21(28)20(27)22(29)24(25)31/h2-6,11-12H,7-10,13H2,1H3,(H,32,35) |
| InChIKey | ULFWVQAGJFLCKD-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.91 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|