C24H18ClF5N4O4 — CID 3343520
N-[3-chloro-4-[4-(2,3,4,5,6-pentafluorophenyl)piperazin-1-yl]phenyl]-2-(4-nitrophenoxy)acetamide (PubChem CID 3343520) has the molecular formula C24H18ClF5N4O4 and a molecular weight of 556.88 g/mol. Its IUPAC name is N-[3-chloro-4-[4-(2,3,4,5,6-pentafluorophenyl)piperazin-1-yl]phenyl]-2-(4-nitrophenoxy)acetamide.
| Compound Name | N-[3-chloro-4-[4-(2,3,4,5,6-pentafluorophenyl)piperazin-1-yl]phenyl]-2-(4-nitrophenoxy)acetamide |
|---|---|
| PubChem CID | 3343520 |
| Molecular Formula | C24H18ClF5N4O4 |
| Molecular Weight | 556.88 g/mol |
| Exact Mass | 556.09 |
| IUPAC Name | N-[3-chloro-4-[4-(2,3,4,5,6-pentafluorophenyl)piperazin-1-yl]phenyl]-2-(4-nitrophenoxy)acetamide |
| SMILES | O=C(COc1ccc([N+](=O)[O-])cc1)Nc1ccc(N2CCN(c3c(F)c(F)c(F)c(F)c3F)CC2)c(Cl)c1 |
| InChI | InChI=1S/C24H18ClF5N4O4/c25-16-11-13(31-18(35)12-38-15-4-2-14(3-5-15)34(36)37)1-6-17(16)32-7-9-33(10-8-32)24-22(29)20(27)19(26)21(28)23(24)30/h1-6,11H,7-10,12H2,(H,31,35) |
| InChIKey | PPJGUQNQLLMMPN-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 87.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.88 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|