C19H21ClN4O4 — CID 18084207
N-[5-chloro-2-(4-methylpiperazin-1-yl)phenyl]-2-(4-nitrophenoxy)acetamide (PubChem CID 18084207) has the molecular formula C19H21ClN4O4 and a molecular weight of 404.85 g/mol. Its IUPAC name is N-[5-chloro-2-(4-methylpiperazin-1-yl)phenyl]-2-(4-nitrophenoxy)acetamide.
| Compound Name | N-[5-chloro-2-(4-methylpiperazin-1-yl)phenyl]-2-(4-nitrophenoxy)acetamide |
|---|---|
| PubChem CID | 18084207 |
| Molecular Formula | C19H21ClN4O4 |
| Molecular Weight | 404.85 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | N-[5-chloro-2-(4-methylpiperazin-1-yl)phenyl]-2-(4-nitrophenoxy)acetamide |
| SMILES | CN1CCN(c2ccc(Cl)cc2NC(=O)COc2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C19H21ClN4O4/c1-22-8-10-23(11-9-22)18-7-2-14(20)12-17(18)21-19(25)13-28-16-5-3-15(4-6-16)24(26)27/h2-7,12H,8-11,13H2,1H3,(H,21,25) |
| InChIKey | OFTKPUJDUJARIV-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 87.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.85 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|