C23H28ClN3O4 — CID 17092281
N-[2-(4-butanoylpiperazin-1-yl)-5-chlorophenyl]-2-(4-methoxyphenoxy)acetamide (PubChem CID 17092281) has the molecular formula C23H28ClN3O4 and a molecular weight of 445.95 g/mol. Its IUPAC name is N-[2-(4-butanoylpiperazin-1-yl)-5-chlorophenyl]-2-(4-methoxyphenoxy)acetamide.
| Compound Name | N-[2-(4-butanoylpiperazin-1-yl)-5-chlorophenyl]-2-(4-methoxyphenoxy)acetamide |
|---|---|
| PubChem CID | 17092281 |
| Molecular Formula | C23H28ClN3O4 |
| Molecular Weight | 445.95 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | N-[2-(4-butanoylpiperazin-1-yl)-5-chlorophenyl]-2-(4-methoxyphenoxy)acetamide |
| SMILES | CCCC(=O)N1CCN(c2ccc(Cl)cc2NC(=O)COc2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C23H28ClN3O4/c1-3-4-23(29)27-13-11-26(12-14-27)21-10-5-17(24)15-20(21)25-22(28)16-31-19-8-6-18(30-2)7-9-19/h5-10,15H,3-4,11-14,16H2,1-2H3,(H,25,28) |
| InChIKey | UBAUQMWWISXREJ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.95 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |