C23H21ClN4O6 — CID 17118163
N-[3-chloro-4-[4-(furan-2-carbonyl)piperazin-1-yl]phenyl]-2-(4-nitrophenoxy)acetamide (PubChem CID 17118163) has the molecular formula C23H21ClN4O6 and a molecular weight of 484.90 g/mol. Its IUPAC name is N-[3-chloro-4-[4-(furan-2-carbonyl)piperazin-1-yl]phenyl]-2-(4-nitrophenoxy)acetamide.
| Compound Name | N-[3-chloro-4-[4-(furan-2-carbonyl)piperazin-1-yl]phenyl]-2-(4-nitrophenoxy)acetamide |
|---|---|
| PubChem CID | 17118163 |
| Molecular Formula | C23H21ClN4O6 |
| Molecular Weight | 484.90 g/mol |
| Exact Mass | 484.11 |
| IUPAC Name | N-[3-chloro-4-[4-(furan-2-carbonyl)piperazin-1-yl]phenyl]-2-(4-nitrophenoxy)acetamide |
| SMILES | O=C(COc1ccc([N+](=O)[O-])cc1)Nc1ccc(N2CCN(C(=O)c3ccco3)CC2)c(Cl)c1 |
| InChI | InChI=1S/C23H21ClN4O6/c24-19-14-16(25-22(29)15-34-18-6-4-17(5-7-18)28(31)32)3-8-20(19)26-9-11-27(12-10-26)23(30)21-2-1-13-33-21/h1-8,13-14H,9-12,15H2,(H,25,29) |
| InChIKey | IFFWJIKHHKTZRP-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 118.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.90 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|