C17H20Cl4N4O — CID 119844349
2-(4-aminophenyl)-1-[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]ethanone;dihydrochloride (PubChem CID 119844349) has the molecular formula C17H20Cl4N4O and a molecular weight of 438.19 g/mol. Its IUPAC name is 2-(4-aminophenyl)-1-[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]ethanone;dihydrochloride.
| Compound Name | 2-(4-aminophenyl)-1-[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]ethanone;dihydrochloride |
|---|---|
| PubChem CID | 119844349 |
| Molecular Formula | C17H20Cl4N4O |
| Molecular Weight | 438.19 g/mol |
| Exact Mass | 436.04 |
| IUPAC Name | 2-(4-aminophenyl)-1-[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]ethanone;dihydrochloride |
| SMILES | Cl.Cl.Nc1ccc(CC(=O)N2CCN(c3ncc(Cl)cc3Cl)CC2)cc1 |
| InChI | InChI=1S/C17H18Cl2N4O.2ClH/c18-13-10-15(19)17(21-11-13)23-7-5-22(6-8-23)16(24)9-12-1-3-14(20)4-2-12;;/h1-4,10-11H,5-9,20H2;2*1H |
| InChIKey | AYGGQLFSMPBTRL-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.19 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|