C14H15Cl2N5 — CID 60870790
6-[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]pyridin-3-amine (PubChem CID 60870790) has the molecular formula C14H15Cl2N5 and a molecular weight of 324.22 g/mol. Its IUPAC name is 6-[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]pyridin-3-amine.
| Compound Name | 6-[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]pyridin-3-amine |
|---|---|
| PubChem CID | 60870790 |
| Molecular Formula | C14H15Cl2N5 |
| Molecular Weight | 324.22 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | 6-[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]pyridin-3-amine |
| SMILES | Nc1ccc(N2CCN(c3ncc(Cl)cc3Cl)CC2)nc1 |
| InChI | InChI=1S/C14H15Cl2N5/c15-10-7-12(16)14(19-8-10)21-5-3-20(4-6-21)13-2-1-11(17)9-18-13/h1-2,7-9H,3-6,17H2 |
| InChIKey | GGFOAFOUTBMMBC-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.22 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |