C19H21Cl2N3O — CID 87006631
1-[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]-3-phenylbutan-1-one (PubChem CID 87006631) has the molecular formula C19H21Cl2N3O and a molecular weight of 378.30 g/mol. Its IUPAC name is 1-[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]-3-phenylbutan-1-one.
| Compound Name | 1-[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]-3-phenylbutan-1-one |
|---|---|
| PubChem CID | 87006631 |
| Molecular Formula | C19H21Cl2N3O |
| Molecular Weight | 378.30 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | 1-[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]-3-phenylbutan-1-one |
| SMILES | CC(CC(=O)N1CCN(c2ncc(Cl)cc2Cl)CC1)c1ccccc1 |
| InChI | InChI=1S/C19H21Cl2N3O/c1-14(15-5-3-2-4-6-15)11-18(25)23-7-9-24(10-8-23)19-17(21)12-16(20)13-22-19/h2-6,12-14H,7-11H2,1H3 |
| InChIKey | OMHJQDKLCUXWGA-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.30 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |