C14H13N3S — CID 104504761
1-(2-isoquinolin-4-yl-1,3-thiazol-4-yl)ethanamine (PubChem CID 104504761) has the molecular formula C14H13N3S and a molecular weight of 255.35 g/mol. Its IUPAC name is 1-(2-isoquinolin-4-yl-1,3-thiazol-4-yl)ethanamine.
| Compound Name | 1-(2-isoquinolin-4-yl-1,3-thiazol-4-yl)ethanamine |
|---|---|
| PubChem CID | 104504761 |
| Molecular Formula | C14H13N3S |
| Molecular Weight | 255.35 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | 1-(2-isoquinolin-4-yl-1,3-thiazol-4-yl)ethanamine |
| SMILES | CC(N)c1csc(-c2cncc3ccccc23)n1 |
| InChI | InChI=1S/C14H13N3S/c1-9(15)13-8-18-14(17-13)12-7-16-6-10-4-2-3-5-11(10)12/h2-9H,15H2,1H3 |
| InChIKey | LMURGUBDZOIXCN-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.35 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |