C12H13NOS — CID 102442271
(1S)-1-[2-(4-methylphenyl)-1,3-thiazol-4-yl]ethanol (PubChem CID 102442271) has the molecular formula C12H13NOS and a molecular weight of 219.31 g/mol. Its IUPAC name is (1S)-1-[2-(4-methylphenyl)-1,3-thiazol-4-yl]ethanol.
| Compound Name | (1S)-1-[2-(4-methylphenyl)-1,3-thiazol-4-yl]ethanol |
|---|---|
| PubChem CID | 102442271 |
| Molecular Formula | C12H13NOS |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.07 |
| IUPAC Name | (1S)-1-[2-(4-methylphenyl)-1,3-thiazol-4-yl]ethanol |
| SMILES | Cc1ccc(-c2nc([C@H](C)O)cs2)cc1 |
| InChI | InChI=1S/C12H13NOS/c1-8-3-5-10(6-4-8)12-13-11(7-15-12)9(2)14/h3-7,9,14H,1-2H3/t9-/m0/s1 |
| InChIKey | GYEPNPFZHQILDV-VIFPVBQESA-N |
| XLogP | 3.17 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |