C12H12BrNOS — CID 103083716
1-[2-(4-bromo-2-methylphenyl)-1,3-thiazol-4-yl]ethanol (PubChem CID 103083716) has the molecular formula C12H12BrNOS and a molecular weight of 298.21 g/mol. Its IUPAC name is 1-[2-(4-bromo-2-methylphenyl)-1,3-thiazol-4-yl]ethanol.
| Compound Name | 1-[2-(4-bromo-2-methylphenyl)-1,3-thiazol-4-yl]ethanol |
|---|---|
| PubChem CID | 103083716 |
| Molecular Formula | C12H12BrNOS |
| Molecular Weight | 298.21 g/mol |
| Exact Mass | 296.98 |
| IUPAC Name | 1-[2-(4-bromo-2-methylphenyl)-1,3-thiazol-4-yl]ethanol |
| SMILES | Cc1cc(Br)ccc1-c1nc(C(C)O)cs1 |
| InChI | InChI=1S/C12H12BrNOS/c1-7-5-9(13)3-4-10(7)12-14-11(6-16-12)8(2)15/h3-6,8,15H,1-2H3 |
| InChIKey | IAIDXADBLZICCT-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.21 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |