C26H28N2O2S4 — CID 98082805
(2S,3S)-1,4-bis[[2-(4-methylphenyl)-1,3-thiazol-4-yl]methylsulfanyl]butane-2,3-diol (PubChem CID 98082805) has the molecular formula C26H28N2O2S4 and a molecular weight of 528.79 g/mol. Its IUPAC name is (2S,3S)-1,4-bis[[2-(4-methylphenyl)-1,3-thiazol-4-yl]methylsulfanyl]butane-2,3-diol.
| Compound Name | (2S,3S)-1,4-bis[[2-(4-methylphenyl)-1,3-thiazol-4-yl]methylsulfanyl]butane-2,3-diol |
|---|---|
| PubChem CID | 98082805 |
| Molecular Formula | C26H28N2O2S4 |
| Molecular Weight | 528.79 g/mol |
| Exact Mass | 528.10 |
| IUPAC Name | (2S,3S)-1,4-bis[[2-(4-methylphenyl)-1,3-thiazol-4-yl]methylsulfanyl]butane-2,3-diol |
| SMILES | Cc1ccc(-c2nc(CSC[C@@H](O)[C@H](O)CSCc3csc(-c4ccc(C)cc4)n3)cs2)cc1 |
| InChI | InChI=1S/C26H28N2O2S4/c1-17-3-7-19(8-4-17)25-27-21(13-33-25)11-31-15-23(29)24(30)16-32-12-22-14-34-26(28-22)20-9-5-18(2)6-10-20/h3-10,13-14,23-24,29-30H,11-12,15-16H2,1-2H3/t23-,24-/m1/s1 |
| InChIKey | WCLYSKAZPMJJTB-DNQXCXABSA-N |
| XLogP | 6.44 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.79 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |