C12H12INS — CID 21355336
2-(4-iodophenyl)-4-propan-2-yl-1,3-thiazole (PubChem CID 21355336) has the molecular formula C12H12INS and a molecular weight of 329.21 g/mol. Its IUPAC name is 2-(4-iodophenyl)-4-propan-2-yl-1,3-thiazole.
| Compound Name | 2-(4-iodophenyl)-4-propan-2-yl-1,3-thiazole |
|---|---|
| PubChem CID | 21355336 |
| Molecular Formula | C12H12INS |
| Molecular Weight | 329.21 g/mol |
| Exact Mass | 328.97 |
| IUPAC Name | 2-(4-iodophenyl)-4-propan-2-yl-1,3-thiazole |
| SMILES | CC(C)c1csc(-c2ccc(I)cc2)n1 |
| InChI | InChI=1S/C12H12INS/c1-8(2)11-7-15-12(14-11)9-3-5-10(13)6-4-9/h3-8H,1-2H3 |
| InChIKey | IMKKZEAYBFCXSS-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.21 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|