C23H21N3O3 — CID 139060722
methanol;1-methyl-2-(2-nitrophenyl)-4,5-diphenylimidazole (PubChem CID 139060722) has the molecular formula C23H21N3O3 and a molecular weight of 387.44 g/mol. Its IUPAC name is methanol;1-methyl-2-(2-nitrophenyl)-4,5-diphenylimidazole.
| Compound Name | methanol;1-methyl-2-(2-nitrophenyl)-4,5-diphenylimidazole |
|---|---|
| PubChem CID | 139060722 |
| Molecular Formula | C23H21N3O3 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | methanol;1-methyl-2-(2-nitrophenyl)-4,5-diphenylimidazole |
| SMILES | CO.Cn1c(-c2ccccc2[N+](=O)[O-])nc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C22H17N3O2.CH4O/c1-24-21(17-12-6-3-7-13-17)20(16-10-4-2-5-11-16)23-22(24)18-14-8-9-15-19(18)25(26)27;1-2/h2-15H,1H3;2H,1H3 |
| InChIKey | CHASWIRBNAXTNG-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|