C20H16N2O — CID 15129898
2-(furan-2-yl)-1-methyl-4,5-diphenylimidazole (PubChem CID 15129898) has the molecular formula C20H16N2O and a molecular weight of 300.36 g/mol. Its IUPAC name is 2-(furan-2-yl)-1-methyl-4,5-diphenylimidazole.
| Compound Name | 2-(furan-2-yl)-1-methyl-4,5-diphenylimidazole |
|---|---|
| PubChem CID | 15129898 |
| Molecular Formula | C20H16N2O |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 2-(furan-2-yl)-1-methyl-4,5-diphenylimidazole |
| SMILES | Cn1c(-c2ccco2)nc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C20H16N2O/c1-22-19(16-11-6-3-7-12-16)18(15-9-4-2-5-10-15)21-20(22)17-13-8-14-23-17/h2-14H,1H3 |
| InChIKey | JOHGSKAUEPATBN-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 30.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |