C14H11NOS — CID 114275041
4-(furan-2-yl)-5-methyl-2-phenyl-1,3-thiazole (PubChem CID 114275041) has the molecular formula C14H11NOS and a molecular weight of 241.32 g/mol. Its IUPAC name is 4-(furan-2-yl)-5-methyl-2-phenyl-1,3-thiazole.
| Compound Name | 4-(furan-2-yl)-5-methyl-2-phenyl-1,3-thiazole |
|---|---|
| PubChem CID | 114275041 |
| Molecular Formula | C14H11NOS |
| Molecular Weight | 241.32 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | 4-(furan-2-yl)-5-methyl-2-phenyl-1,3-thiazole |
| SMILES | Cc1sc(-c2ccccc2)nc1-c1ccco1 |
| InChI | InChI=1S/C14H11NOS/c1-10-13(12-8-5-9-16-12)15-14(17-10)11-6-3-2-4-7-11/h2-9H,1H3 |
| InChIKey | NKBZDTKZBPPCLY-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.32 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |