C19H15NS — CID 59871677
5-methyl-2-phenyl-4-(4-prop-2-ynylphenyl)-1,3-thiazole (PubChem CID 59871677) has the molecular formula C19H15NS and a molecular weight of 289.40 g/mol. Its IUPAC name is 5-methyl-2-phenyl-4-(4-prop-2-ynylphenyl)-1,3-thiazole.
| Compound Name | 5-methyl-2-phenyl-4-(4-prop-2-ynylphenyl)-1,3-thiazole |
|---|---|
| PubChem CID | 59871677 |
| Molecular Formula | C19H15NS |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 5-methyl-2-phenyl-4-(4-prop-2-ynylphenyl)-1,3-thiazole |
| SMILES | C#CCc1ccc(-c2nc(-c3ccccc3)sc2C)cc1 |
| InChI | InChI=1S/C19H15NS/c1-3-7-15-10-12-16(13-11-15)18-14(2)21-19(20-18)17-8-5-4-6-9-17/h1,4-6,8-13H,7H2,2H3 |
| InChIKey | CGYROCVNBPTAPU-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|