C21H21ClN2OS — CID 108769918
3-chloro-2,2-dimethyl-N-[4-(5-methyl-2-phenyl-1,3-thiazol-4-yl)phenyl]propanamide (PubChem CID 108769918) has the molecular formula C21H21ClN2OS and a molecular weight of 384.93 g/mol. Its IUPAC name is 3-chloro-2,2-dimethyl-N-[4-(5-methyl-2-phenyl-1,3-thiazol-4-yl)phenyl]propanamide.
| Compound Name | 3-chloro-2,2-dimethyl-N-[4-(5-methyl-2-phenyl-1,3-thiazol-4-yl)phenyl]propanamide |
|---|---|
| PubChem CID | 108769918 |
| Molecular Formula | C21H21ClN2OS |
| Molecular Weight | 384.93 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | 3-chloro-2,2-dimethyl-N-[4-(5-methyl-2-phenyl-1,3-thiazol-4-yl)phenyl]propanamide |
| SMILES | Cc1sc(-c2ccccc2)nc1-c1ccc(NC(=O)C(C)(C)CCl)cc1 |
| InChI | InChI=1S/C21H21ClN2OS/c1-14-18(24-19(26-14)16-7-5-4-6-8-16)15-9-11-17(12-10-15)23-20(25)21(2,3)13-22/h4-12H,13H2,1-3H3,(H,23,25) |
| InChIKey | RYOYKBMODWRGDS-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.93 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|