C17H14ClN3OS — CID 4640164
1-(4-chlorophenyl)-3-(5-methyl-4-phenyl-1,3-thiazol-2-yl)urea (PubChem CID 4640164) has the molecular formula C17H14ClN3OS and a molecular weight of 343.84 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-(5-methyl-4-phenyl-1,3-thiazol-2-yl)urea.
| Compound Name | 1-(4-chlorophenyl)-3-(5-methyl-4-phenyl-1,3-thiazol-2-yl)urea |
|---|---|
| PubChem CID | 4640164 |
| Molecular Formula | C17H14ClN3OS |
| Molecular Weight | 343.84 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | 1-(4-chlorophenyl)-3-(5-methyl-4-phenyl-1,3-thiazol-2-yl)urea |
| SMILES | Cc1sc(NC(=O)Nc2ccc(Cl)cc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C17H14ClN3OS/c1-11-15(12-5-3-2-4-6-12)20-17(23-11)21-16(22)19-14-9-7-13(18)8-10-14/h2-10H,1H3,(H2,19,20,21,22) |
| InChIKey | ZNPBCQNUEYALJJ-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.84 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |