C16H11Br2NS — CID 78907473
2,4-bis(4-bromophenyl)-5-methyl-1,3-thiazole (PubChem CID 78907473) has the molecular formula C16H11Br2NS and a molecular weight of 409.15 g/mol. Its IUPAC name is 2,4-bis(4-bromophenyl)-5-methyl-1,3-thiazole.
| Compound Name | 2,4-bis(4-bromophenyl)-5-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 78907473 |
| Molecular Formula | C16H11Br2NS |
| Molecular Weight | 409.15 g/mol |
| Exact Mass | 406.90 |
| IUPAC Name | 2,4-bis(4-bromophenyl)-5-methyl-1,3-thiazole |
| SMILES | Cc1sc(-c2ccc(Br)cc2)nc1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C16H11Br2NS/c1-10-15(11-2-6-13(17)7-3-11)19-16(20-10)12-4-8-14(18)9-5-12/h2-9H,1H3 |
| InChIKey | UWLSAYSGGDMKHM-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.15 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |