C16H11BrClNS — CID 79839841
4-(4-bromophenyl)-2-(2-chlorophenyl)-5-methyl-1,3-thiazole (PubChem CID 79839841) has the molecular formula C16H11BrClNS and a molecular weight of 364.70 g/mol. Its IUPAC name is 4-(4-bromophenyl)-2-(2-chlorophenyl)-5-methyl-1,3-thiazole.
| Compound Name | 4-(4-bromophenyl)-2-(2-chlorophenyl)-5-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 79839841 |
| Molecular Formula | C16H11BrClNS |
| Molecular Weight | 364.70 g/mol |
| Exact Mass | 362.95 |
| IUPAC Name | 4-(4-bromophenyl)-2-(2-chlorophenyl)-5-methyl-1,3-thiazole |
| SMILES | Cc1sc(-c2ccccc2Cl)nc1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C16H11BrClNS/c1-10-15(11-6-8-12(17)9-7-11)19-16(20-10)13-4-2-3-5-14(13)18/h2-9H,1H3 |
| InChIKey | ICCLCUFHLJLYPW-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.70 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |