C14H13N3OS — CID 82059120
4-N-[4-(furan-2-yl)-5-methyl-1,3-thiazol-2-yl]benzene-1,4-diamine (PubChem CID 82059120) has the molecular formula C14H13N3OS and a molecular weight of 271.35 g/mol. Its IUPAC name is 4-N-[4-(furan-2-yl)-5-methyl-1,3-thiazol-2-yl]benzene-1,4-diamine.
| Compound Name | 4-N-[4-(furan-2-yl)-5-methyl-1,3-thiazol-2-yl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 82059120 |
| Molecular Formula | C14H13N3OS |
| Molecular Weight | 271.35 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 4-N-[4-(furan-2-yl)-5-methyl-1,3-thiazol-2-yl]benzene-1,4-diamine |
| SMILES | Cc1sc(Nc2ccc(N)cc2)nc1-c1ccco1 |
| InChI | InChI=1S/C14H13N3OS/c1-9-13(12-3-2-8-18-12)17-14(19-9)16-11-6-4-10(15)5-7-11/h2-8H,15H2,1H3,(H,16,17) |
| InChIKey | MTTLRWPNESXXRZ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.35 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|