C16H14BrN3S — CID 53387372
4-N-[4-(4-bromophenyl)-5-methyl-1,3-thiazol-2-yl]benzene-1,4-diamine (PubChem CID 53387372) has the molecular formula C16H14BrN3S and a molecular weight of 360.28 g/mol. Its IUPAC name is 4-N-[4-(4-bromophenyl)-5-methyl-1,3-thiazol-2-yl]benzene-1,4-diamine.
| Compound Name | 4-N-[4-(4-bromophenyl)-5-methyl-1,3-thiazol-2-yl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 53387372 |
| Molecular Formula | C16H14BrN3S |
| Molecular Weight | 360.28 g/mol |
| Exact Mass | 359.01 |
| IUPAC Name | 4-N-[4-(4-bromophenyl)-5-methyl-1,3-thiazol-2-yl]benzene-1,4-diamine |
| SMILES | Cc1sc(Nc2ccc(N)cc2)nc1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C16H14BrN3S/c1-10-15(11-2-4-12(17)5-3-11)20-16(21-10)19-14-8-6-13(18)7-9-14/h2-9H,18H2,1H3,(H,19,20) |
| InChIKey | IHUMSQBJLRKNFQ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.28 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|