C18H18N2OS — CID 93206365
4-[[4-(4-ethylphenyl)-5-methyl-1,3-thiazol-2-yl]amino]phenol (PubChem CID 93206365) has the molecular formula C18H18N2OS and a molecular weight of 310.42 g/mol. Its IUPAC name is 4-[[4-(4-ethylphenyl)-5-methyl-1,3-thiazol-2-yl]amino]phenol.
| Compound Name | 4-[[4-(4-ethylphenyl)-5-methyl-1,3-thiazol-2-yl]amino]phenol |
|---|---|
| PubChem CID | 93206365 |
| Molecular Formula | C18H18N2OS |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 4-[[4-(4-ethylphenyl)-5-methyl-1,3-thiazol-2-yl]amino]phenol |
| SMILES | CCc1ccc(-c2nc(Nc3ccc(O)cc3)sc2C)cc1 |
| InChI | InChI=1S/C18H18N2OS/c1-3-13-4-6-14(7-5-13)17-12(2)22-18(20-17)19-15-8-10-16(21)11-9-15/h4-11,21H,3H2,1-2H3,(H,19,20) |
| InChIKey | HPZSEMJEXYYPNA-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|