C11H11NO2S — CID 105477646
4-[2-(hydroxymethyl)-5-methyl-1,3-thiazol-4-yl]phenol (PubChem CID 105477646) has the molecular formula C11H11NO2S and a molecular weight of 221.28 g/mol. Its IUPAC name is 4-[2-(hydroxymethyl)-5-methyl-1,3-thiazol-4-yl]phenol.
| Compound Name | 4-[2-(hydroxymethyl)-5-methyl-1,3-thiazol-4-yl]phenol |
|---|---|
| PubChem CID | 105477646 |
| Molecular Formula | C11H11NO2S |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.05 |
| IUPAC Name | 4-[2-(hydroxymethyl)-5-methyl-1,3-thiazol-4-yl]phenol |
| SMILES | Cc1sc(CO)nc1-c1ccc(O)cc1 |
| InChI | InChI=1S/C11H11NO2S/c1-7-11(12-10(6-13)15-7)8-2-4-9(14)5-3-8/h2-5,13-14H,6H2,1H3 |
| InChIKey | LPUIVTYLLNVCLK-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |