C11H12N2O2 — CID 105456043
4-[2-(hydroxymethyl)-5-methyl-1H-imidazol-4-yl]phenol (PubChem CID 105456043) has the molecular formula C11H12N2O2 and a molecular weight of 204.23 g/mol. Its IUPAC name is 4-[2-(hydroxymethyl)-5-methyl-1H-imidazol-4-yl]phenol.
| Compound Name | 4-[2-(hydroxymethyl)-5-methyl-1H-imidazol-4-yl]phenol |
|---|---|
| PubChem CID | 105456043 |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | 4-[2-(hydroxymethyl)-5-methyl-1H-imidazol-4-yl]phenol |
| SMILES | Cc1[nH]c(CO)nc1-c1ccc(O)cc1 |
| InChI | InChI=1S/C11H12N2O2/c1-7-11(13-10(6-14)12-7)8-2-4-9(15)5-3-8/h2-5,14-15H,6H2,1H3,(H,12,13) |
| InChIKey | DLARDKJBMYYDRK-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 69.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |