About ethane;2-phenylfuran
ethane;2-phenylfuran (PubChem CID 143157762) has the molecular formula C12H14O
and a molecular weight of 174.24 g/mol. Its IUPAC name is ethane;2-phenylfuran.
Molecular Properties
| Compound Name | ethane;2-phenylfuran |
| PubChem CID | 143157762 |
| Molecular Formula | C12H14O |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | ethane;2-phenylfuran |
| SMILES | CC.c1ccc(-c2ccco2)cc1 |
| InChI | InChI=1S/C10H8O.C2H6/c1-2-5-9(6-3-1)10-7-4-8-11-10;1-2/h1-8H;1-2H3 |
| InChIKey | FBDLAVYZMCGYRL-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;2-phenylfuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-phenylfuran?
The IUPAC name of ethane;2-phenylfuran (CID 143157762) is ethane;2-phenylfuran.
What is the SMILES notation for ethane;2-phenylfuran?
The canonical SMILES for ethane;2-phenylfuran is CC.c1ccc(-c2ccco2)cc1.
What is the InChIKey of ethane;2-phenylfuran?
The InChIKey is FBDLAVYZMCGYRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O.C2H6/c1-2-5-9(6-3-1)10-7-4-8-11-10;1-2/h1-8H;1-2H3.
What are the key properties of ethane;2-phenylfuran?
ethane;2-phenylfuran has a molecular weight of 174.24 g/mol, XLogP of 3.97, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-phenylfuran is sourced from PubChem (CID 143157762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).