C13H15NO — CID 159375984
1-[4-(furan-2-yl)phenyl]-N,N-dimethylmethanamine (PubChem CID 159375984) has the molecular formula C13H15NO and a molecular weight of 201.27 g/mol. Its IUPAC name is 1-[4-(furan-2-yl)phenyl]-N,N-dimethylmethanamine.
| Compound Name | 1-[4-(furan-2-yl)phenyl]-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 159375984 |
| Molecular Formula | C13H15NO |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | 1-[4-(furan-2-yl)phenyl]-N,N-dimethylmethanamine |
| SMILES | CN(C)Cc1ccc(-c2ccco2)cc1 |
| InChI | InChI=1S/C13H15NO/c1-14(2)10-11-5-7-12(8-6-11)13-4-3-9-15-13/h3-9H,10H2,1-2H3 |
| InChIKey | LKIAHCVACDKFHQ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |