C14H9Cl2N3O2 — CID 134103285
5,6-dichloro-1-methyl-2-(2-nitrophenyl)benzimidazole (PubChem CID 134103285) has the molecular formula C14H9Cl2N3O2 and a molecular weight of 322.15 g/mol. Its IUPAC name is 5,6-dichloro-1-methyl-2-(2-nitrophenyl)benzimidazole.
| Compound Name | 5,6-dichloro-1-methyl-2-(2-nitrophenyl)benzimidazole |
|---|---|
| PubChem CID | 134103285 |
| Molecular Formula | C14H9Cl2N3O2 |
| Molecular Weight | 322.15 g/mol |
| Exact Mass | 321.01 |
| IUPAC Name | 5,6-dichloro-1-methyl-2-(2-nitrophenyl)benzimidazole |
| SMILES | Cn1c(-c2ccccc2[N+](=O)[O-])nc2cc(Cl)c(Cl)cc21 |
| InChI | InChI=1S/C14H9Cl2N3O2/c1-18-13-7-10(16)9(15)6-11(13)17-14(18)8-4-2-3-5-12(8)19(20)21/h2-7H,1H3 |
| InChIKey | WLXVQYIJCCWEQD-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 60.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.15 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|