C23H18Cl2N4O4S — CID 141108207
5,6-dichloro-2-[2-(1,3-dihydroisoindol-2-yl)ethyl]-1-(2-nitrophenyl)sulfonylbenzimidazole (PubChem CID 141108207) has the molecular formula C23H18Cl2N4O4S and a molecular weight of 517.39 g/mol. Its IUPAC name is 5,6-dichloro-2-[2-(1,3-dihydroisoindol-2-yl)ethyl]-1-(2-nitrophenyl)sulfonylbenzimidazole.
| Compound Name | 5,6-dichloro-2-[2-(1,3-dihydroisoindol-2-yl)ethyl]-1-(2-nitrophenyl)sulfonylbenzimidazole |
|---|---|
| PubChem CID | 141108207 |
| Molecular Formula | C23H18Cl2N4O4S |
| Molecular Weight | 517.39 g/mol |
| Exact Mass | 516.04 |
| IUPAC Name | 5,6-dichloro-2-[2-(1,3-dihydroisoindol-2-yl)ethyl]-1-(2-nitrophenyl)sulfonylbenzimidazole |
| SMILES | O=[N+]([O-])c1ccccc1S(=O)(=O)n1c(CCN2Cc3ccccc3C2)nc2cc(Cl)c(Cl)cc21 |
| InChI | InChI=1S/C23H18Cl2N4O4S/c24-17-11-19-21(12-18(17)25)28(34(32,33)22-8-4-3-7-20(22)29(30)31)23(26-19)9-10-27-13-15-5-1-2-6-16(15)14-27/h1-8,11-12H,9-10,13-14H2 |
| InChIKey | PFXBQAYJVNKNIB-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 98.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.39 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|