C19H12Cl2N2O5S — CID 6975498
(2R)-2-(3,4-dichlorophenyl)-3-(2-nitrophenyl)sulfonyl-2H-1,3-benzoxazole (PubChem CID 6975498) has the molecular formula C19H12Cl2N2O5S and a molecular weight of 451.29 g/mol. Its IUPAC name is (2R)-2-(3,4-dichlorophenyl)-3-(2-nitrophenyl)sulfonyl-2H-1,3-benzoxazole.
| Compound Name | (2R)-2-(3,4-dichlorophenyl)-3-(2-nitrophenyl)sulfonyl-2H-1,3-benzoxazole |
|---|---|
| PubChem CID | 6975498 |
| Molecular Formula | C19H12Cl2N2O5S |
| Molecular Weight | 451.29 g/mol |
| Exact Mass | 449.98 |
| IUPAC Name | (2R)-2-(3,4-dichlorophenyl)-3-(2-nitrophenyl)sulfonyl-2H-1,3-benzoxazole |
| SMILES | O=[N+]([O-])c1ccccc1S(=O)(=O)N1c2ccccc2O[C@@H]1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C19H12Cl2N2O5S/c20-13-10-9-12(11-14(13)21)19-22(15-5-1-3-7-17(15)28-19)29(26,27)18-8-4-2-6-16(18)23(24)25/h1-11,19H/t19-/m1/s1 |
| InChIKey | WIYQHEXMFBUELJ-LJQANCHMSA-N |
| XLogP | 5.19 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.29 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|