C15H13ClN2O5S — CID 23120009
5-(4-chloro-3-nitrophenyl)sulfonyl-3,4-dihydro-2H-1,5-benzoxazepine (PubChem CID 23120009) has the molecular formula C15H13ClN2O5S and a molecular weight of 368.80 g/mol. Its IUPAC name is 5-(4-chloro-3-nitrophenyl)sulfonyl-3,4-dihydro-2H-1,5-benzoxazepine.
| Compound Name | 5-(4-chloro-3-nitrophenyl)sulfonyl-3,4-dihydro-2H-1,5-benzoxazepine |
|---|---|
| PubChem CID | 23120009 |
| Molecular Formula | C15H13ClN2O5S |
| Molecular Weight | 368.80 g/mol |
| Exact Mass | 368.02 |
| IUPAC Name | 5-(4-chloro-3-nitrophenyl)sulfonyl-3,4-dihydro-2H-1,5-benzoxazepine |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)N2CCCOc3ccccc32)ccc1Cl |
| InChI | InChI=1S/C15H13ClN2O5S/c16-12-7-6-11(10-14(12)18(19)20)24(21,22)17-8-3-9-23-15-5-2-1-4-13(15)17/h1-2,4-7,10H,3,8-9H2 |
| InChIKey | MXZIYEBYVIEGGH-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.80 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|