C12H11NO4S — CID 154757419
4-(furan-3-ylsulfonyl)-2,3-dihydro-1,4-benzoxazine (PubChem CID 154757419) has the molecular formula C12H11NO4S and a molecular weight of 265.29 g/mol. Its IUPAC name is 4-(furan-3-ylsulfonyl)-2,3-dihydro-1,4-benzoxazine.
| Compound Name | 4-(furan-3-ylsulfonyl)-2,3-dihydro-1,4-benzoxazine |
|---|---|
| PubChem CID | 154757419 |
| Molecular Formula | C12H11NO4S |
| Molecular Weight | 265.29 g/mol |
| Exact Mass | 265.04 |
| IUPAC Name | 4-(furan-3-ylsulfonyl)-2,3-dihydro-1,4-benzoxazine |
| SMILES | O=S(=O)(c1ccoc1)N1CCOc2ccccc21 |
| InChI | InChI=1S/C12H11NO4S/c14-18(15,10-5-7-16-9-10)13-6-8-17-12-4-2-1-3-11(12)13/h1-5,7,9H,6,8H2 |
| InChIKey | XEAJEBMXQWZEIN-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.29 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |