C12H15NO5S — CID 43378631
4-(2,3-dihydro-1,4-benzoxazin-4-ylsulfonyl)butanoic acid (PubChem CID 43378631) has the molecular formula C12H15NO5S and a molecular weight of 285.32 g/mol. Its IUPAC name is 4-(2,3-dihydro-1,4-benzoxazin-4-ylsulfonyl)butanoic acid.
| Compound Name | 4-(2,3-dihydro-1,4-benzoxazin-4-ylsulfonyl)butanoic acid |
|---|---|
| PubChem CID | 43378631 |
| Molecular Formula | C12H15NO5S |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | 4-(2,3-dihydro-1,4-benzoxazin-4-ylsulfonyl)butanoic acid |
| SMILES | O=C(O)CCCS(=O)(=O)N1CCOc2ccccc21 |
| InChI | InChI=1S/C12H15NO5S/c14-12(15)6-3-9-19(16,17)13-7-8-18-11-5-2-1-4-10(11)13/h1-2,4-5H,3,6-9H2,(H,14,15) |
| InChIKey | URVVZQMPUAWHKF-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |