C11H12N2O5S — CID 28822178
3-[(3-oxo-2,4-dihydroquinoxalin-1-yl)sulfonyl]propanoic acid (PubChem CID 28822178) has the molecular formula C11H12N2O5S and a molecular weight of 284.29 g/mol. Its IUPAC name is 3-[(3-oxo-2,4-dihydroquinoxalin-1-yl)sulfonyl]propanoic acid.
| Compound Name | 3-[(3-oxo-2,4-dihydroquinoxalin-1-yl)sulfonyl]propanoic acid |
|---|---|
| PubChem CID | 28822178 |
| Molecular Formula | C11H12N2O5S |
| Molecular Weight | 284.29 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | 3-[(3-oxo-2,4-dihydroquinoxalin-1-yl)sulfonyl]propanoic acid |
| SMILES | O=C(O)CCS(=O)(=O)N1CC(=O)Nc2ccccc21 |
| InChI | InChI=1S/C11H12N2O5S/c14-10-7-13(19(17,18)6-5-11(15)16)9-4-2-1-3-8(9)12-10/h1-4H,5-7H2,(H,12,14)(H,15,16) |
| InChIKey | QZRICXOODQGGSY-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.29 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |