C10H13N3O3S — CID 55126845
N,N-dimethyl-3-oxo-2,4-dihydroquinoxaline-1-sulfonamide (PubChem CID 55126845) has the molecular formula C10H13N3O3S and a molecular weight of 255.30 g/mol. Its IUPAC name is N,N-dimethyl-3-oxo-2,4-dihydroquinoxaline-1-sulfonamide.
| Compound Name | N,N-dimethyl-3-oxo-2,4-dihydroquinoxaline-1-sulfonamide |
|---|---|
| PubChem CID | 55126845 |
| Molecular Formula | C10H13N3O3S |
| Molecular Weight | 255.30 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | N,N-dimethyl-3-oxo-2,4-dihydroquinoxaline-1-sulfonamide |
| SMILES | CN(C)S(=O)(=O)N1CC(=O)Nc2ccccc21 |
| InChI | InChI=1S/C10H13N3O3S/c1-12(2)17(15,16)13-7-10(14)11-8-5-3-4-6-9(8)13/h3-6H,7H2,1-2H3,(H,11,14) |
| InChIKey | UFULONKAMKKALL-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.30 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |