C10H11N3O — CID 63172914
4-ethanimidoyl-1,3-dihydroquinoxalin-2-one (PubChem CID 63172914) has the molecular formula C10H11N3O and a molecular weight of 189.22 g/mol. Its IUPAC name is 4-ethanimidoyl-1,3-dihydroquinoxalin-2-one.
| Compound Name | 4-ethanimidoyl-1,3-dihydroquinoxalin-2-one |
|---|---|
| PubChem CID | 63172914 |
| Molecular Formula | C10H11N3O |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.09 |
| IUPAC Name | 4-ethanimidoyl-1,3-dihydroquinoxalin-2-one |
| SMILES | [H]/N=C(\C)N1CC(=O)Nc2ccccc21 |
| InChI | InChI=1S/C10H11N3O/c1-7(11)13-6-10(14)12-8-4-2-3-5-9(8)13/h2-5,11H,6H2,1H3,(H,12,14)/b11-7+ |
| InChIKey | KAVIYUJXYNHYBE-YRNVUSSQSA-N |
| XLogP | 1.44 |
| TPSA | 56.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|