C10H10N4O3 — CID 43164015
2-oxo-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)acetohydrazide (PubChem CID 43164015) has the molecular formula C10H10N4O3 and a molecular weight of 234.22 g/mol. Its IUPAC name is 2-oxo-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)acetohydrazide.
| Compound Name | 2-oxo-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)acetohydrazide |
|---|---|
| PubChem CID | 43164015 |
| Molecular Formula | C10H10N4O3 |
| Molecular Weight | 234.22 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | 2-oxo-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)acetohydrazide |
| SMILES | NNC(=O)C(=O)N1CC(=O)Nc2ccccc21 |
| InChI | InChI=1S/C10H10N4O3/c11-13-9(16)10(17)14-5-8(15)12-6-3-1-2-4-7(6)14/h1-4H,5,11H2,(H,12,15)(H,13,16) |
| InChIKey | GVLXPWFDACPAPN-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.22 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|