C13H19N5O — CID 116513050
N-amino-N'-butyl-3-oxo-2,4-dihydroquinoxaline-1-carboximidamide (PubChem CID 116513050) has the molecular formula C13H19N5O and a molecular weight of 261.33 g/mol. Its IUPAC name is N-amino-N'-butyl-3-oxo-2,4-dihydroquinoxaline-1-carboximidamide.
| Compound Name | N-amino-N'-butyl-3-oxo-2,4-dihydroquinoxaline-1-carboximidamide |
|---|---|
| PubChem CID | 116513050 |
| Molecular Formula | C13H19N5O |
| Molecular Weight | 261.33 g/mol |
| Exact Mass | 261.16 |
| IUPAC Name | N-amino-N'-butyl-3-oxo-2,4-dihydroquinoxaline-1-carboximidamide |
| SMILES | CCCC/N=C(\NN)N1CC(=O)Nc2ccccc21 |
| InChI | InChI=1S/C13H19N5O/c1-2-3-8-15-13(17-14)18-9-12(19)16-10-6-4-5-7-11(10)18/h4-7H,2-3,8-9,14H2,1H3,(H,15,17)(H,16,19) |
| InChIKey | PNNDXFLMPNZHPM-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.33 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|