C12H11N5O2 — CID 64524021
4-(3-amino-1H-pyrazole-5-carbonyl)-1,3-dihydroquinoxalin-2-one (PubChem CID 64524021) has the molecular formula C12H11N5O2 and a molecular weight of 257.25 g/mol. Its IUPAC name is 4-(3-amino-1H-pyrazole-5-carbonyl)-1,3-dihydroquinoxalin-2-one.
| Compound Name | 4-(3-amino-1H-pyrazole-5-carbonyl)-1,3-dihydroquinoxalin-2-one |
|---|---|
| PubChem CID | 64524021 |
| Molecular Formula | C12H11N5O2 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | 4-(3-amino-1H-pyrazole-5-carbonyl)-1,3-dihydroquinoxalin-2-one |
| SMILES | Nc1cc(C(=O)N2CC(=O)Nc3ccccc32)[nH]n1 |
| InChI | InChI=1S/C12H11N5O2/c13-10-5-8(15-16-10)12(19)17-6-11(18)14-7-3-1-2-4-9(7)17/h1-5H,6H2,(H,14,18)(H3,13,15,16) |
| InChIKey | WLRDYBXWRPGKQG-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 104.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |