C11H12N2O4 — CID 79345427
2-hydroxyethyl 3-oxo-2,4-dihydroquinoxaline-1-carboxylate (PubChem CID 79345427) has the molecular formula C11H12N2O4 and a molecular weight of 236.23 g/mol. Its IUPAC name is 2-hydroxyethyl 3-oxo-2,4-dihydroquinoxaline-1-carboxylate.
| Compound Name | 2-hydroxyethyl 3-oxo-2,4-dihydroquinoxaline-1-carboxylate |
|---|---|
| PubChem CID | 79345427 |
| Molecular Formula | C11H12N2O4 |
| Molecular Weight | 236.23 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 2-hydroxyethyl 3-oxo-2,4-dihydroquinoxaline-1-carboxylate |
| SMILES | O=C1CN(C(=O)OCCO)c2ccccc2N1 |
| InChI | InChI=1S/C11H12N2O4/c14-5-6-17-11(16)13-7-10(15)12-8-3-1-2-4-9(8)13/h1-4,14H,5-7H2,(H,12,15) |
| InChIKey | LOZAANMFCOOCMA-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.23 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |