C10H12N6O — CID 83031637
N-(diaminomethylidene)-3-oxo-2,4-dihydroquinoxaline-1-carboximidamide (PubChem CID 83031637) has the molecular formula C10H12N6O and a molecular weight of 232.25 g/mol. Its IUPAC name is N-(diaminomethylidene)-3-oxo-2,4-dihydroquinoxaline-1-carboximidamide.
| Compound Name | N-(diaminomethylidene)-3-oxo-2,4-dihydroquinoxaline-1-carboximidamide |
|---|---|
| PubChem CID | 83031637 |
| Molecular Formula | C10H12N6O |
| Molecular Weight | 232.25 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | N-(diaminomethylidene)-3-oxo-2,4-dihydroquinoxaline-1-carboximidamide |
| SMILES | [H]/N=C(\N=C(N)N)N1CC(=O)Nc2ccccc21 |
| InChI | InChI=1S/C10H12N6O/c11-9(12)15-10(13)16-5-8(17)14-6-3-1-2-4-7(6)16/h1-4H,5H2,(H,14,17)(H5,11,12,13,15) |
| InChIKey | ZANSUJVRBRPUTR-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 120.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.25 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|