C14H10F2N2O3S — CID 86799239
4-(2,3-difluorophenyl)sulfonyl-1,3-dihydroquinoxalin-2-one (PubChem CID 86799239) has the molecular formula C14H10F2N2O3S and a molecular weight of 324.31 g/mol. Its IUPAC name is 4-(2,3-difluorophenyl)sulfonyl-1,3-dihydroquinoxalin-2-one.
| Compound Name | 4-(2,3-difluorophenyl)sulfonyl-1,3-dihydroquinoxalin-2-one |
|---|---|
| PubChem CID | 86799239 |
| Molecular Formula | C14H10F2N2O3S |
| Molecular Weight | 324.31 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | 4-(2,3-difluorophenyl)sulfonyl-1,3-dihydroquinoxalin-2-one |
| SMILES | O=C1CN(S(=O)(=O)c2cccc(F)c2F)c2ccccc2N1 |
| InChI | InChI=1S/C14H10F2N2O3S/c15-9-4-3-7-12(14(9)16)22(20,21)18-8-13(19)17-10-5-1-2-6-11(10)18/h1-7H,8H2,(H,17,19) |
| InChIKey | RNROUKLQEKNTCN-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.31 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |