C15H12N2O5S — CID 110667520
4-(1,3-benzodioxol-5-ylsulfonyl)-1,3-dihydroquinoxalin-2-one (PubChem CID 110667520) has the molecular formula C15H12N2O5S and a molecular weight of 332.34 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-ylsulfonyl)-1,3-dihydroquinoxalin-2-one.
| Compound Name | 4-(1,3-benzodioxol-5-ylsulfonyl)-1,3-dihydroquinoxalin-2-one |
|---|---|
| PubChem CID | 110667520 |
| Molecular Formula | C15H12N2O5S |
| Molecular Weight | 332.34 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | 4-(1,3-benzodioxol-5-ylsulfonyl)-1,3-dihydroquinoxalin-2-one |
| SMILES | O=C1CN(S(=O)(=O)c2ccc3c(c2)OCO3)c2ccccc2N1 |
| InChI | InChI=1S/C15H12N2O5S/c18-15-8-17(12-4-2-1-3-11(12)16-15)23(19,20)10-5-6-13-14(7-10)22-9-21-13/h1-7H,8-9H2,(H,16,18) |
| InChIKey | KWYFIPDRFSOYIY-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.34 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |