C18H20N2O4S — CID 110669805
1-(1,3-benzodioxol-5-ylsulfonyl)-4-propan-2-yl-2,3-dihydroquinoxaline (PubChem CID 110669805) has the molecular formula C18H20N2O4S and a molecular weight of 360.44 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylsulfonyl)-4-propan-2-yl-2,3-dihydroquinoxaline.
| Compound Name | 1-(1,3-benzodioxol-5-ylsulfonyl)-4-propan-2-yl-2,3-dihydroquinoxaline |
|---|---|
| PubChem CID | 110669805 |
| Molecular Formula | C18H20N2O4S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylsulfonyl)-4-propan-2-yl-2,3-dihydroquinoxaline |
| SMILES | CC(C)N1CCN(S(=O)(=O)c2ccc3c(c2)OCO3)c2ccccc21 |
| InChI | InChI=1S/C18H20N2O4S/c1-13(2)19-9-10-20(16-6-4-3-5-15(16)19)25(21,22)14-7-8-17-18(11-14)24-12-23-17/h3-8,11,13H,9-10,12H2,1-2H3 |
| InChIKey | ROCBIXPLPJKLNS-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |